|
Name |
Acrylic acid
|
| Molecular Formula | C3H4O2 | |
| IUPAC Name* |
prop-2-enoic acid
|
|
| SMILES |
C=CC(=O)O
|
|
| InChI |
InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5)
|
|
| InChIKey |
NIXOWILDQLNWCW-UHFFFAOYSA-N
|
|
| Synonyms |
ACRYLIC ACID; 2-Propenoic acid; 79-10-7; Propenoic acid; prop-2-enoic acid; Vinylformic acid; Acroleic acid; Ethylenecarboxylic acid; Propene acid; Propenoate; ACRYLATE; Glacial acrylic acid; Acrylic acid, glacial; Kyselina akrylova; 9003-01-4; RCRA waste number U008; Carbopol 934p; NSC 4765; Carbopol 940; J94PBK7X8S; Acrylic resin; Aron; Antiprex A; CHEBI:18308; Versicol E9; NSC4765; Acrylic acid resin; Acrysol ase-75; C3:1n-1; Versicol E 7; Versicol E15; NSC-4765; Acrysol A 1; Acrysol A 3; Acrysol A 5; Acrysol A-1; Acrysol AC 5; Carbopol 960; Carboset 515; Primal Ase 60; Revacryl A191; Versicol K 11; Versicol S 25; Viscalex HV 30; Dispex C40; Acrysol WS-24; Cyguard 266; Joncryl 678; Jurimer AC 10H; Jurimer AC 10P; Nalfloc 636; Good-rite K 37; Revacryl A 191; 25987-55-7; Junlon 110; Viscon 103; Good-rite K 702; Good-rite K 732; Good-rite WS 801; NCGC00166246-01; Synthemul 90-588; Aron A 10H; Carboset Resin No. 515; OLD 01; PA 11M; PAA-25; Caswell No. 009A; Acrylates; P 11H; P-11H; WS 24; Acide acrylique; Acido acrilio; Acido acrilio [Spanish]; Acide acrylique [French]; WS 801; Kyselina akrylova [Czech]; R968; CCRIS 737; HSDB 1421; EINECS 201-177-9; UN2218; RCRA waste no. U008; UNII-J94PBK7X8S; allenediol; BRN 0635743; AI3-15717; Acrysol lmw-20X; XPA; ACRLYLIC ACID; Dow Latex 354; Acrylic acid, inhibited; CH2=CHCOOH; DSSTox_CID_28; (stabilized with MEHQ); Carbomer 934 (NF); Carbomer 940 (NF); Carbomer 941 (NF); Carbopol 910 (TN); Carbopol 934 (TN); Carbopol 940 (TN); Carbopol 941 (TN); Carbomer 934P (NF); Carbopol 934P (TN); Carbomer 910 (USAN); ACRYLIC ACID [MI]; Carbomer 1342 (NF); Carbopol 1342 (TN); EC 201-177-9; ACRYLIC ACID [HSDB]; ACRYLIC ACID [IARC]; ACRYLIC ACID [INCI]; DSSTox_RID_79425; WLN: QV1U1; DSSTox_GSID_39229; Araldite GT 7004 acrylate; 4-02-00-01455 (Beilstein Handbook Reference); UN 2218 (Salt/Mix); Acrylic acid, p.a., 99%; CHEMBL1213529; DTXSID0039229; ZINC895281; STR00040; Tox21_112372; LMFA01030193; MFCD00004367; NSC106034; NSC106035; NSC106036; NSC106037; NSC112122; NSC112123; NSC114472; NSC165257; NSC226569; STL281870; AKOS000118799; DB02579; NSC-106034; NSC-106035; NSC-106036; NSC-106037; NSC-112122; NSC-112123; NSC-114472; NSC-165257; NSC-226569; CAS-79-10-7; BP-30259; A0141; FT-0621875; FT-0660730; EN300-17959; C00511; C19501; D03392; D03393; D03394; D03395; D03396; D03397; Acrylic Acid contains 200ppm MEHQ as inhibitor; Acrylic acid, inhibited [UN2218] [Corrosive]; A830860; Q324628; Z57127944; F0001-2070; Acrylic acid, anhydrous, contains 200 ppm MEHQ as inhibitor, 99%; Acrylic acid, SAJ first grade, >=97.0%, contains 190-210 ppm MEHQ as stabilizer; 55927-87-2
|
|
| CAS | 79-10-7 | |
| PubChem CID | 6581 | |
| ChEMBL ID | CHEMBL1213529 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 72.06 | ALogp: | 0.3 |
| HBD: | 1 | HBA: | 2 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 5 | QED Weighted: | 0.462 |
| Caco-2 Permeability: | -4.974 | MDCK Permeability: | 0.00002780 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.035 |
| Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.028 |
| Blood-Brain-Barrier Penetration (BBB): | 0.755 | Plasma Protein Binding (PPB): | 16.35% |
| Volume Distribution (VD): | 0.352 | Fu: | 74.54% |
| CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.072 |
| CYP2C19-inhibitor: | 0.039 | CYP2C19-substrate: | 0.056 |
| CYP2C9-inhibitor: | 0.138 | CYP2C9-substrate: | 0.23 |
| CYP2D6-inhibitor: | 0.021 | CYP2D6-substrate: | 0.142 |
| CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.048 |
| Clearance (CL): | 4.755 | Half-life (T1/2): | 0.853 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.688 |
| Drug-inuced Liver Injury (DILI): | 0.121 | AMES Toxicity: | 0.046 |
| Rat Oral Acute Toxicity: | 0.962 | Maximum Recommended Daily Dose: | 0.016 |
| Skin Sensitization: | 0.774 | Carcinogencity: | 0.176 |
| Eye Corrosion: | 0.989 | Eye Irritation: | 0.995 |
| Respiratory Toxicity: | 0.639 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000639 | ![]() |
0.381 | D04CRL | ![]() |
0.357 | ||
| ENC000009 | ![]() |
0.357 | D02FLB | ![]() |
0.333 | ||
| ENC001278 | ![]() |
0.308 | D0R3QY | ![]() |
0.308 | ||
| ENC001220 | ![]() |
0.300 | D0M8AB | ![]() |
0.294 | ||
| ENC000058 | ![]() |
0.294 | D09PUL | ![]() |
0.263 | ||
| ENC000022 | ![]() |
0.294 | D0G4JI | ![]() |
0.263 | ||
| ENC001095 | ![]() |
0.292 | D08QGD | ![]() |
0.250 | ||
| ENC001586 | ![]() |
0.280 | D07CWD | ![]() |
0.222 | ||
| ENC000879 | ![]() |
0.273 | D01BQK | ![]() |
0.222 | ||
| ENC000061 | ![]() |
0.263 | D0R9BG | ![]() |
0.222 | ||