|
Name |
Phloretin
|
| Molecular Formula | C15H14O5 | |
| IUPAC Name* |
3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one
|
|
| SMILES |
C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O)O)O)O
|
|
| InChI |
InChI=1S/C15H14O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-2,4-5,7-8,16-17,19-20H,3,6H2
|
|
| InChIKey |
VGEREEWJJVICBM-UHFFFAOYSA-N
|
|
| Synonyms |
phloretin; 60-82-2; Dihydronaringenin; 3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one; Phloretol; 3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone; 1-Propanone, 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-; NSC 407292; MFCD00002288; beta-(p-Hydroxyphenyl)phloropropiophenone; 2',4',6'-Trihydroxy-3-(p-hydroxyphenyl)propiophenone; 2',4',6'-Trihydroxy-3-(4-Hydroxyphenyl)propiophenone; C15H14O5; NSC407292; S5J5OE47MK; beta-(p-Hydroxyphenyl)-2,4,6-trihydroxypropiophenone; beta-(4-Hydroxyphenyl)-2,4,6-trihydroxypropiophenone; CHEMBL45068; 2',4',6'-Trihydroxy-3-(4-hydroxyphenyl)-propiophenone; Propiophenone, 2',4',6'-trihydroxy-3-(p-hydroxyphenyl)-; CHEBI:17276; NSC-407292; 2',4,4',6'-Tetrahydroxydihydrochalcone; .beta.-(p-Hydroxyphenyl)phloropropiophenone; 2',4,4',6'-Tetrahydroxy-Dihydrochalcone; NSC 407292;RJC 02792; 3-(4-Hydroxy-phenyl)-1-(2,4,6-trihydroxy-phenyl)-propan-1-one; SMR000326783; CCRIS 7459; SR-01000076081; EINECS 200-488-7; UNII-S5J5OE47MK; Asebogenol; 2uxi; G50; phloretin (natural); Spectrum_001295; 4,2',4',6'-Tetrahydroxydihydrochalcone; Phloretin, >=99%; SpecPlus_000333; PHLORETIN [MI]; PHLORETIN [INCI]; Spectrum2_000681; Spectrum3_001036; Spectrum4_001172; Spectrum5_001698; Lopac-P-7912; DSSTox_CID_2393; cid_4788; DSSTox_RID_76569; DSSTox_GSID_22393; Lopac0_001012; Oprea1_824722; REGID_for_CID_4788; SCHEMBL38131; BSPBio_002851; KBioGR_001803; KBioSS_001775; SPECTRUM300554; MLS000728507; MLS000859922; MLS006012024; BIDD:ER0174; DivK1c_006429; SPBio_000801; GTPL4285; DTXSID6022393; FEMA NO. 4390; BCBcMAP01_000040; BDBM23446; KBio1_001373; KBio2_001775; KBio2_004343; KBio2_006911; KBio3_002071; Phloretin - CAS 60-82-2; ZINC47553; HMS2224N17; HMS3263K05; HMS3332J03; HMS3656I07; BCP28296; HY-N0142; TNP00255; Tox21_202854; Tox21_501012; CCG-38573; LMPK12120525; O1P165; RJC 02792; s2342; STL372996; AKOS015856338; AC-7995; CS-1477; DB07810; LP01012; SDCCGMLS-0066637.P001; SDCCGSBI-0050985.P003; CAS-60-82-2; Phloretin, analytical reference material; SMP1_000238; NCGC00015840-01; NCGC00015840-02; NCGC00015840-03; NCGC00015840-04; NCGC00015840-05; NCGC00015840-06; NCGC00015840-07; NCGC00015840-08; NCGC00015840-09; NCGC00015840-18; NCGC00094304-01; NCGC00094304-02; NCGC00094304-03; NCGC00094304-04; NCGC00260400-01; NCGC00261697-01; AS-14100; SY017103; DB-053714; EU-0101012; FT-0603256; P1966; SW219308-1; C00774; P 7912; 2',6'-Trihydroxy-3-(p-hydroxyphenyl)propiophenone; Q-100701; Q2268463; SR-01000076081-1; SR-01000076081-7; SR-01000076081-8; .beta.-(p-Hydroxyphenyl)-2,6-trihydroxypropiophenone; BRD-K15563106-001-02-4; BRD-K15563106-001-10-7; Propiophenone,4',6'-trihydroxy-3-(p-hydroxyphenyl)-; .beta.-(p-Hydroxyphenyl)-2,4,6-trihydroxypropiophenone; 1-(2,4,6-trihydroxyphenyl)-3-(4-hydroxyphenyl)-1-propanone; 3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanon; 3-(4-HYDROXYPHENYL)-1-(2,4,6-TRIHYDROXYPHENYL)-PROPAN-1-ONE [FHFI]
|
|
| CAS | 60-82-2 | |
| PubChem CID | 4788 | |
| ChEMBL ID | CHEMBL45068 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 274.27 | ALogp: | 2.6 |
| HBD: | 4 | HBA: | 5 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 98.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 20 | QED Weighted: | 0.642 |
| Caco-2 Permeability: | -4.962 | MDCK Permeability: | 0.00001020 |
| Pgp-inhibitor: | 0.058 | Pgp-substrate: | 0.006 |
| Human Intestinal Absorption (HIA): | 0.569 | 20% Bioavailability (F20%): | 0.998 |
| 30% Bioavailability (F30%): | 0.998 |
| Blood-Brain-Barrier Penetration (BBB): | 0.023 | Plasma Protein Binding (PPB): | 93.96% |
| Volume Distribution (VD): | 0.563 | Fu: | 5.86% |
| CYP1A2-inhibitor: | 0.939 | CYP1A2-substrate: | 0.137 |
| CYP2C19-inhibitor: | 0.726 | CYP2C19-substrate: | 0.05 |
| CYP2C9-inhibitor: | 0.787 | CYP2C9-substrate: | 0.934 |
| CYP2D6-inhibitor: | 0.828 | CYP2D6-substrate: | 0.803 |
| CYP3A4-inhibitor: | 0.852 | CYP3A4-substrate: | 0.146 |
| Clearance (CL): | 15.737 | Half-life (T1/2): | 0.923 |
| hERG Blockers: | 0.051 | Human Hepatotoxicity (H-HT): | 0.119 |
| Drug-inuced Liver Injury (DILI): | 0.675 | AMES Toxicity: | 0.725 |
| Rat Oral Acute Toxicity: | 0.37 | Maximum Recommended Daily Dose: | 0.149 |
| Skin Sensitization: | 0.947 | Carcinogencity: | 0.245 |
| Eye Corrosion: | 0.013 | Eye Irritation: | 0.949 |
| Respiratory Toxicity: | 0.077 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000940 | ![]() |
0.507 | D04XEG | ![]() |
0.432 | ||
| ENC001548 | ![]() |
0.449 | D06KYN | ![]() |
0.429 | ||
| ENC005996 | ![]() |
0.446 | D0J7RK | ![]() |
0.427 | ||
| ENC002499 | ![]() |
0.440 | D0U3YB | ![]() |
0.402 | ||
| ENC002584 | ![]() |
0.438 | D00LFB | ![]() |
0.373 | ||
| ENC002581 | ![]() |
0.429 | D01CRB | ![]() |
0.364 | ||
| ENC001550 | ![]() |
0.423 | D04AIT | ![]() |
0.361 | ||
| ENC001533 | ![]() |
0.423 | D0B3QM | ![]() |
0.353 | ||
| ENC001438 | ![]() |
0.423 | D05CKR | ![]() |
0.338 | ||
| ENC005600 | ![]() |
0.418 | D00KRE | ![]() |
0.337 | ||