![]() |
Name |
2-(1H-indol-3-yl)acetaldehyde
|
Molecular Formula | C10H9NO | |
IUPAC Name* |
2-(1H-indol-3-yl)acetaldehyde
|
|
SMILES |
C1=CC=C2C(=C1)C(=CN2)CC=O
|
|
InChI |
InChI=1S/C10H9NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,6-7,11H,5H2
|
|
InChIKey |
WHOOUMGHGSPMGR-UHFFFAOYSA-N
|
|
Synonyms |
2-(1H-indol-3-yl)acetaldehyde; indole-3-acetaldehyde; 2591-98-2; Indoleacetaldehyde; 1H-indole-3-acetaldehyde; Tryptaldehyde; indol-3-ylacetaldehyde; 1H-Indol-3-ylacetaldehyde; 2-(indol-3-yl)acetaldehyde; 2-(3-Indolyl)acetaldehyde; A346H8E8WU; CCRIS 5808; indole acetaldehyde; Indol-3-acetaldehyde; (indol-3-yl)acetaldehyde; UNII-A346H8E8WU; 1H-Indol-3-ylacetaldehyde #; SCHEMBL107104; CHEBI:18086; DTXSID90180582; ZINC895327; AKOS006237176; AB02302; FT-0646077; C00637; EN300-1601797; 3AA2B26B-6E90-473F-AE5E-CBF2BB1ACB49; Q27102813
|
|
CAS | 2591-98-2 | |
PubChem CID | 800 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 159.18 | ALogp: | 1.3 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 32.9 | Aromatic Rings: | 2 |
Heavy Atoms: | 12 | QED Weighted: | 0.671 |
Caco-2 Permeability: | -4.515 | MDCK Permeability: | 0.00002130 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.044 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.01 |
30% Bioavailability (F30%): | 0.055 |
Blood-Brain-Barrier Penetration (BBB): | 0.743 | Plasma Protein Binding (PPB): | 47.49% |
Volume Distribution (VD): | 1.283 | Fu: | 47.15% |
CYP1A2-inhibitor: | 0.958 | CYP1A2-substrate: | 0.778 |
CYP2C19-inhibitor: | 0.492 | CYP2C19-substrate: | 0.147 |
CYP2C9-inhibitor: | 0.051 | CYP2C9-substrate: | 0.904 |
CYP2D6-inhibitor: | 0.575 | CYP2D6-substrate: | 0.873 |
CYP3A4-inhibitor: | 0.124 | CYP3A4-substrate: | 0.16 |
Clearance (CL): | 10.237 | Half-life (T1/2): | 0.842 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.101 |
Drug-inuced Liver Injury (DILI): | 0.49 | AMES Toxicity: | 0.572 |
Rat Oral Acute Toxicity: | 0.766 | Maximum Recommended Daily Dose: | 0.484 |
Skin Sensitization: | 0.958 | Carcinogencity: | 0.243 |
Eye Corrosion: | 0.729 | Eye Irritation: | 0.988 |
Respiratory Toxicity: | 0.646 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000043 | ![]() |
0.636 | D05EJG | ![]() |
0.571 | ||
ENC000341 | ![]() |
0.634 | D0K0KH | ![]() |
0.333 | ||
ENC000363 | ![]() |
0.628 | D0AN7B | ![]() |
0.317 | ||
ENC000140 | ![]() |
0.571 | D09ZIS | ![]() |
0.298 | ||
ENC004706 | ![]() |
0.571 | D0O6IZ | ![]() |
0.297 | ||
ENC005018 | ![]() |
0.560 | D0K1XK | ![]() |
0.296 | ||
ENC000694 | ![]() |
0.560 | D00YLW | ![]() |
0.296 | ||
ENC005609 | ![]() |
0.560 | D05OIS | ![]() |
0.289 | ||
ENC005757 | ![]() |
0.533 | D0BV3J | ![]() |
0.288 | ||
ENC000999 | ![]() |
0.532 | D0Z6UC | ![]() |
0.286 |