|
Name |
Butyric Acid
|
| Molecular Formula | C4H8O2 | |
| IUPAC Name* |
butanoic acid
|
|
| SMILES |
CCCC(=O)O
|
|
| InChI |
InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)
|
|
| InChIKey |
FERIUCNNQQJTOY-UHFFFAOYSA-N
|
|
| Synonyms |
butyric acid; butanoic acid; 107-92-6; n-Butyric acid; n-Butanoic acid; propylformic acid; ethylacetic acid; 1-propanecarboxylic acid; Butanic acid; butyrate; 1-Butyric acid; Buttersaeure; butanoate; Butyric acid (natural); Kyselina maselna; Propanecarboxylic acid; Buttersaeure [German]; 1-butanoic acid; FEMA No. 2221; FEMA Number 2221; Kyselina maselna [Czech]; CCRIS 6552; HSDB 940; butoic acid; 2-butanoate; NSC 8415; MFCD00002814; UN2820; AI3-15306; C4:0; CH3-[CH2]2-COOH; 40UIR9Q29H; 67254-79-9; CHEBI:30772; NSC8415; butanate; propylformate; NSC-8415; Butyrate sodium; 1-butanoate; propanecarboxylate; 1-butyrate; Butyric acid [UN2820] [Corrosive]; Sodium n-butyrate; 1-propanecarboxylate; DSSTox_CID_1515; DSSTox_RID_76192; DSSTox_GSID_21515; BUA; acide butyrique; CAS-107-92-6; Butyric Acid (Normal); EINECS 203-532-3; BRN 0906770; UNII-40UIR9Q29H; sodium-butyrate; acide butanoique; Honey robber; Butyricum acidum; ethyl acetic acid; 1ugp; 3umq; butanoic acid, 4; Nat. Butyric Acid; TNFa + NaBut; Butyrate, sodium salt; Butyric acid [UN2820] [Corrosive]; BUTYRIC_ACID; n-C3H7COOH; TNFa + Sodium Butyrate; Butyric acid, >=99%; NORMAL BUTYRIC ACID; bmse000402; BUTYRIC ACID [MI]; EC 203-532-3; NATURAL BUTYRIC ACID; NCIMech_000707; BUTYRIC ACID [FCC]; WLN: QV3; BUTYRIC ACID [HSDB]; BUTYRIC ACID [INCI]; BUTYRIC ACID [VANDF]; 4-02-00-00779 (Beilstein Handbook Reference); CHEMBL14227; BUTYRIC ACID [WHO-DD]; Butyric acid, >=99%, FG; N-BUTYRIC ACID [FHFI]; GTPL1059; BUTYRICUM ACIDUM [HPUS]; DTXSID8021515; BDBM26109; Butyric acid, analytical standard; Bio1_000444; Bio1_000933; Bio1_001422; N-butyric acid, ethyl acetic acid; ZINC895132; STR06290; Tox21_202382; Tox21_300164; CCG-35836; LMFA01010004; STL169349; AKOS000118961; DB03568; UN 2820; NCGC00247914-01; NCGC00247914-02; NCGC00247914-05; NCGC00253919-01; NCGC00259931-01; BP-21420; NCI60_001424; Butyric acid, natural, >=99%, FCC, FG; B0754; FT-0623295; FT-0686717; Butyric acid 1000 microg/mL in Acetonitrile; Butyric acid, SAJ special grade, >=99.5%; EN300-21334; C00246; Q193213; W-108732; BRD-K05878375-236-02-4; 9B27B3D0-9643-40EC-9A5F-7CA1A6ED7F9F; F2191-0094; Z104495380; butanoic acid, butanic acid, n-butyric acid, ethylacetic acid, propylformic acid, 1-propanecarboxylic acid
|
|
| CAS | 107-92-6 | |
| PubChem CID | 264 | |
| ChEMBL ID | CHEMBL14227 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 88.11 | ALogp: | 0.8 |
| HBD: | 1 | HBA: | 2 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 6 | QED Weighted: | 0.552 |
| Caco-2 Permeability: | -4.807 | MDCK Permeability: | 0.00026024 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.019 |
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.001 |
| 30% Bioavailability (F30%): | 0.014 |
| Blood-Brain-Barrier Penetration (BBB): | 0.887 | Plasma Protein Binding (PPB): | 43.11% |
| Volume Distribution (VD): | 0.245 | Fu: | 63.03% |
| CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.23 |
| CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.136 |
| CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.93 |
| CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.24 |
| CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.045 |
| Clearance (CL): | 7.386 | Half-life (T1/2): | 0.832 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.075 |
| Drug-inuced Liver Injury (DILI): | 0.059 | AMES Toxicity: | 0.011 |
| Rat Oral Acute Toxicity: | 0.154 | Maximum Recommended Daily Dose: | 0.013 |
| Skin Sensitization: | 0.213 | Carcinogencity: | 0.11 |
| Eye Corrosion: | 0.986 | Eye Irritation: | 0.993 |
| Respiratory Toxicity: | 0.046 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000315 | ![]() |
0.565 | D0EP8X | ![]() |
0.435 | ||
| ENC000058 | ![]() |
0.529 | D06VNK | ![]() |
0.400 | ||
| ENC000643 | ![]() |
0.500 | D0M8AB | ![]() |
0.368 | ||
| ENC000677 | ![]() |
0.500 | D0Y7ZD | ![]() |
0.357 | ||
| ENC000445 | ![]() |
0.458 | D0R3QY | ![]() |
0.357 | ||
| ENC000030 | ![]() |
0.448 | D04CRL | ![]() |
0.353 | ||
| ENC000656 | ![]() |
0.435 | D0FD0H | ![]() |
0.345 | ||
| ENC000639 | ![]() |
0.435 | D0O4GY | ![]() |
0.345 | ||
| ENC000735 | ![]() |
0.407 | D00ENY | ![]() |
0.333 | ||
| ENC000263 | ![]() |
0.406 | D0Y3KG | ![]() |
0.323 | ||