Herb Latin Name | Rhizoma Corydalis | Herb English Name | Corydalis tuber |
Herb Pinyin Name | YAN HU SUO | Herb Chinese Name | 延胡索 |
Properties | Warm; Pungent; Bitter | Meridians | Spleen; Liver; Heart |
Use Part | rhizome | Function |
1. To invigorate blood and promote qi circulation; 2. To stop pain
|
Indication |
Chest and rib-side pain, pain in stomach duct and abdomen, neuralgia, gastrointestinal spasm, amenorrhea and dysmenorrhea, postpartum stasis stagnation abdominal pain, painful swelling from knocks and falls.
|
Toxicity | NA |
Therapeutic Class | Qi Regulating Drugs | Therapeutic Class (Chinese) | 理气药 |
HERB ID | HERB006353 | SymMap ID | 451 |
NPASS ID | NPO27143 | Taxonomy ID | 3463 |
|
---|
Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification |
Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |
---|---|---|---|---|
Rotundine | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)OC)OC)C=C1)OC | 355.4 | 5417 | NPC16107 |
Canadine | COC1=C(C2=C(CC3C4=CC5=C(C=C4CCN3C2)OCO5)C=C1)OC | 339.4 | 34458 | NPC41178 |
Pseudoprotopine | CN1CCC2=CC3=C(C=C2C(=O)CC4=CC5=C(C=C4C1)OCO5)OCO3 | 353.4 | 185559 | NPC86469 |
Corydalin | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC | 369.5 | 326549 | NPC2663 |
D-Alt(a1-2a)L-Psif | C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O | 342.3 | 53301851 | NPC111897 |
Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |