| Herb Latin Name | Concha Haliotidis | Herb English Name | Sea-ear Shell |
| Herb Pinyin Name | SHI JUE MING | Herb Chinese Name | 石决明 |
| Properties | Cold; Salty | Meridians | Liver |
| Use Part | Haliotis diversicolor Reeve.;Haliotis discus hannai Ino.;Haliotis ovina Gmelin.;Haliotis ruber ( Leach).;Haliotis asinine Linnaeus.;Hatiotis laevigata (Donovan). | Function |
Treatment of headache and dizziness, blurred vision due to nebula, optic atrophy and night blindness.
|
| Indication |
1. Improves eyesight.2. Haemostatic.
|
Toxicity | NA |
| Therapeutic Class | For calming liver and containing wind | Therapeutic Class (Chinese) | 平肝息风 |
| HERB ID | HERB005061 | SymMap ID | NA |
| NPASS ID | NPO24859 | Taxonomy ID | NA |
|
|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |
|---|---|---|---|---|
| Risedronic Acid | C1=CC(=CN=C1)CC(O)(P(=O)(O)O)P(=O)(O)O | 283.113 | 44400168 | NPC315320 |
| 1,2-Benzenedi(carboxylic-14C)acid, dibutyl ester | CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC | 282.33 | 171810 | NPC271027 |
| Propoxyphene, (R,R)- | CCC(=O)OC(CC1=CC=CC=C1)(C2=CC=CC=C2)C(C)CN(C)C | 339.5 | 6093219 | NPC316375 |
| Actonel with calcium (copackaged) | C1=CC(=CN=C1)CC(O)(P(=O)(O)O)P(=O)(O)O.C(=O)([O-])[O-].[Ca+2] | 383.2 | 24847992 | NPC154770 |
| methyl (3aS,4S,6E,10E,11aR)-10-methyl-4-[(Z)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylate | CC=C(C)C(=O)OC1CC(=CCCC(=CC2C1C(=C)C(=O)O2)C)C(=O)OC | 374.4 | 102063123 | NPC116489 |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |