| Herb Latin Name | Fructus Ligustri lucidi | Herb English Name | fruit of Glossy privet |
| Herb Pinyin Name | NU ZHEN ZI | Herb Chinese Name | 女贞子 |
| Properties | Cool; Sweet; Bitter | Meridians | Liver; Kidney |
| Use Part | Ligustru lucidu Ait. | Function |
Treament of vertigo, tinnitus, weakness in the loins and knees, premature whitening of hair and impaired eyesight due to deficiency of yin of the liver and kidney.
|
| Indication |
1. Its component oleanolic acid can prevent and relieve cyclophosphamide-induced leukocytopenia in mice.2. Enhancing the anoxia tolerance of mice under atmospheric pressure.3. Increasing coronary flow in rabbits in vitro.4. Relaxing adrenaline-induced vasocontricyion in rabbits in vitro.5. Lowering the level of blood lipid.
|
Toxicity | NA |
| Therapeutic Class | For tonifying weakness | Therapeutic Class (Chinese) | 补虚 |
| HERB ID | HERB004237 | SymMap ID | NA |
| NPASS ID | NPO18105 | Taxonomy ID | NA |
|
|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |
|---|---|---|---|---|
| Salidroside | C1=CC(=CC=C1CCOC2C(C(C(C(O2)CO)O)O)O)O | 300.3 | 159278 | NPC157338 |
| Keracyanin cation | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC4=C(C=C(C=C4[O+]=C3C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O)O | 595.5 | 441674 | NPC34241 |
| Ligustroside | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC=C(C=C3)O | 524.5 | 14136859 | NPC169398 |
| 10-Hydroxyligstroside | COC(=O)C1=COC(C(=CCO)C1CC(=O)OCCC2=CC=C(C=C2)O)OC3C(C(C(C(O3)CO)O)O)O | 540.5 | 14756316 | NPC82614 |
| (2R,3S,4S,5R)-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxane-3,4,5-triol | C1=CC(=CC=C1CCOC2C(C(C(C(O2)CO)O)O)O)O | 300.3 | 21123711 | NPC168326 |
| Urs-12-en-28-oic acid, 3-(acetyloxy)-, (3beta)- | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC(=O)C)C)C)C2C1C)C)C(=O)O | 498.7 | 25032406 | NPC123625 |
| Malvidin 3-rutinoside-5-glucoside | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC(=C(C(=C6)OC)O)OC)O)O)O)O)O)O | 801.7 | 44256985 | NPC238188 |
| Oleanolic Acid (Caryophyllin) | CC1(CC2C(CCC3(C2=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C)C(C1)C(=O)O)C | 456.7 | 49867939 | NPC112866 |
| Ursolic acid (Malol) | CC1CC(C2CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1C)C)C(=O)O | 456.7 | 49867942 | NPC62469 |
| methyl (4S,5Z,6R)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxo-ethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-4H-pyran-3-carboxylate | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC(=C(C=C3)O)O | 540.5 | 53297357 | NPC197598 |
| NA | c1cc(c(cc1[C@H]1CC(=O)c2c(cc(cc2O1)[O-])O)O)O | 287.247 | NA | NPC135602 |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |