| Herb Latin Name | Radix Zanthoxyli | Herb English Name | Shinyleaf Pricklyash Root |
| Herb Pinyin Name | LIANG MIAN ZHEN | Herb Chinese Name | 两面针 |
| Properties | Mild; Pungent; Bitter | Meridians | Stomach; Liver |
| Use Part | NA | Function |
To promote the flow of qi, relieve pain, to eliminate blood stasis, to promote blood circulation and dispel wind.
|
| Indication |
Treatment of traumatic injury, rheumatic arthralgia, stomach-ache, teethache, bitten by venomous snake, applied for burn caused by hot liquid or fire.
|
Toxicity | Toxic |
| Therapeutic Class | Wind-Dampnessdispelling And Colddispersing Medicinal | Therapeutic Class (Chinese) | 祛风湿散寒药 |
| HERB ID | HERB003384 | SymMap ID | 245 |
| NPASS ID | NPO2517 | Taxonomy ID | NA |
|
|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |
|---|---|---|---|---|
| Paraben | c1cc(ccc1C(=O)O)O | 138.122 | 3702506 | NPC29883 |
| Nitidine | C[N+]1=CC2=CC(=C(C=C2C3=C1C4=CC5=C(C=C4C=C3)OCO5)OC)OC | 348.4 | 4501 | NPC271215 |
| Methylparaben | COC(=O)C1=CC=C(C=C1)O | 152.15 | 7456 | NPC131192 |
| Oxynitidine | CN1C2=C(C=CC3=CC4=C(C=C32)OCO4)C5=CC(=C(C=C5C1=O)OC)OC | 363.4 | 97597 | NPC52410 |
| 5,6,7-Trimethoxycoumarin | COC1=C(C(=C2C=CC(=O)OC2=C1)OC)OC | 236.22 | 148724 | NPC27239 |
| Epi-zanthomuurolanine | CC(C)C1CCC(C2C1C=C(CC2)CC3C4=C(C=CC(=C4OC)OC)C5=C(N3C)C6=CC7=C(C=C6C=C5)OCO7)(C)OC | 583.8 | 44567549 | NPC311934 |
| zanthocadinanine B | CC(C)C1CCC(C2C1C=C(CC2)CC3C4=C(C=CC(=C4OC)OC)C5=C(N3C)C6=CC7=C(C=C6C=C5)OCO7)(C)OC | 583.8 | 44567551 | NPC259446 |
| epi-zanthocadinanine B | CC(C)C1CCC(C2C1C=C(CC2)CC3C4=C(C=CC(=C4OC)OC)C5=C(N3C)C6=CC7=C(C=C6C=C5)OCO7)(C)OC | 583.8 | 44567552 | NPC130162 |
| 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C=C5)OC)O)O)O)O)O)O)O)O | 608.5 | 53384378 | NPC288714 |
| Horsfieldin | COC1=C(C=C(C=C1)C2C3COC(C3CO2)C4=CC5=C(C=C4)OCO5)O | 356.4 | 101389128 | NPC186858 |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |