| Herb Latin Name | Fructus Amomi Rotundus | Herb English Name | Round Cardamon Fruit |
| Herb Pinyin Name | DOU KOU | Herb Chinese Name | 豆蔻 |
| Properties | NA | Meridians | NA |
| Use Part | NA | Function |
To resolve damp, to remove stagnancy of food, and to promote digestion.
|
| Indication |
Treatment of loss of appetite due to accumulation of turbid damp in the spleen and stomach, feeling of suffocation in the chest with anorexia at the early stage of damp-warm syndromes, nausea, vomiting, distension and pain in the chest and abdomen caused
|
Toxicity | NA |
| Therapeutic Class | Dampness Removing Drugs | Therapeutic Class (Chinese) | 化湿药 |
| HERB ID | HERB001378 | SymMap ID | 112 |
| NPASS ID | NPO20705 | Taxonomy ID | NA |
|
|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |
|---|---|---|---|---|
| Myristicin | COC1=CC(=CC2=C1OCO2)CC=C | 192.21 | 4276 | NPC119949 |
| Methyleugenol | COC1=C(C=C(C=C1)CC=C)OC | 178.23 | 7127 | NPC292792 |
| Elemicin | COC1=CC(=CC(=C1OC)OC)CC=C | 208.25 | 10248 | NPC204120 |
| Trimyristin | CCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC | 723.2 | 11148 | NPC230828 |
| 4-Terpineol, (+/-)- | CC1=CCC(CC1)(C(C)C)O | 154.25 | 11230 | NPC177112 |
| (+)-Camphene | CC1(C2CCC(C2)C1=C)C | 136.23 | 92221 | NPC227670 |
| Tetradecanoate | CCCCCCCCCCCCCC(=O)[O-] | 227.36 | 4075158 | NPC301583 |
| Glyceryl Trioleate | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | 885.4 | 5497163 | NPC136434 |
| CID 10487440 | C=CCC1=CC2=C(C=C1)OCO2 | 174.14 | 10487440 | NPC235901 |
| Oleanolic Acid (Caryophyllin) | CC1(CC2C(CCC3(C2=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C)C(C1)C(=O)O)C | 456.7 | 49867939 | NPC112866 |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |