| Herb Latin Name | Cortex Lycii Radicis | Herb English Name | root - bark of Chinese Wolfberry |
| Herb Pinyin Name | DI GU PI | Herb Chinese Name | 地骨皮 |
| Properties | Cold; Sweet | Meridians | Lung; Kidney |
| Use Part | NA | Function |
To reduce heat in blood, to relieve consumptive fever, and to remove heat from the lung.
|
| Indication |
1. Its decoction, infusion, tincture and injection exert a hypotensive effect on anesthetized or unanesthetized animals.2. Antipyretic. Reducing vaccine-induced fever in rabbits.3. Its extract lowers serum cholesterol level in rabbits,4. Its decoction reduces blood sugar level in rabbits5. An active component, betaine, possesses a lipocaic effect.
|
Toxicity | NA |
| Therapeutic Class | Asthenic Heat Dispelling Drugs | Therapeutic Class (Chinese) | 清虚热药 |
| HERB ID | HERB001249 | SymMap ID | 103 |
| NPASS ID | NPO8251 | Taxonomy ID | NA |
|
|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Drug ID | Drug Name | Drug Brand Name | Drug Dose | Drug Dosage Form | Food Dose | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |
|---|---|---|---|---|
| Paraben | c1cc(ccc1C(=O)O)O | 138.122 | 3702506 | NPC29883 |
| 4-Methoxysalicylic acid | COC1=CC(=C(C=C1)C(=O)O)O | 168.15 | 75231 | NPC307732 |
| 3-(3,4-Dihydroxyphenyl)propionic acid | C1=CC(=C(C=C1CCC(=O)O)O)O | 182.17 | 348154 | NPC222084 |
| Methyl 3-(3,4-dihydroxyphenyl)propanoate | COC(=O)CCC1=CC(=C(C=C1)O)O | 196.2 | 579668 | NPC148969 |
| p-Coumaric acid | C1=CC(=CC=C1C=CC(=O)O)O | 164.16 | 637542 | NPC81010 |
| 3-Hydroxy-1-(4-hydroxyphenyl)propan-1-one | C1=CC(=CC=C1C(=O)CCO)O | 166.17 | 638759 | NPC114682 |
| Nicotinic acid,[carboxyl-14C] | C1=CC(=CN=C1)C(=O)O | 125.1 | 644263 | NPC283923 |
| 3-Amino-4-hydroxy-4-oxobutanoate | C(C(C(=O)O)N)C(=O)[O-] | 132.09 | 4083066 | NPC313851 |
| N-Trans-feruloyltramine | COC1=C(C=CC(=C1)C=CC(=O)NCCC2=CC=C(C=C2)O)O | 313.3 | 5280537 | NPC195749 |
| Kukoamine A | C1=CC(=C(C=C1CCC(=O)NCCCNCCCCNCCCNC(=O)CCC2=CC(=C(C=C2)O)O)O)O | 530.7 | 5318865 | NPC271808 |
| Paprazine | C1=CC(=CC=C1CCNC(=O)C=CC2=CC=C(C=C2)O)O | 283.32 | 5372945 | NPC24101 |
| Dihydro-N-Caffeoyltyramine | C1=CC(=CC=C1CCNC(=O)CCC2=CC(=C(C=C2)O)O)O | 301.34 | 16119668 | NPC268572 |
| Lyciumin C | CC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CC2=CN(C(C(=O)N1)NC(=O)C(CC3=CC=C(C=C3)O)NC(=O)C4CCCN4C(=O)C5CCC(=O)N5)C6=CC=CC=C26)C(=O)OC)CO)CC7=CC=CC=C7 | 978.1 | 44584331 | NPC285343 |
| (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate | COC1=C(C=CC(=C1)C=CC(=O)O)[O-] | 193.18 | 54691413 | NPC70741 |
| Ingredient Name | SMILES | Molecular Weight | PubChem CID | NPASS ID |