| Drug Name |
Brexpiprazole
|
||
| Synonyms |
Brexpiprazole
|
||
| Drug Type |
Small molecular drug
|
||
| Company |
Lundbeck; Otsuka America Pharmaceutical
|
||
| Summary |
Brexpiprazole is a serotonin–dopamine activity modulator used in the treatment of major depressive disorder as an adjunct, schizophrenia, and agitation associated with dementia due to Alzheimer’s disease.
|
||
|
Formula |
C25H27N3O2S
|
| Canonical SMILES |
C1CN(CCN1CCCCOC2=CC3=C(C=C2)C=CC(=O)N3)C4=C5C=CSC5=CC=C4
|
|
| InChI |
1S/C25H27N3O2S/c29-25-9-7-19-6-8-20(18-22(19)26-25)30-16-2-1-11-27-12-14-28(15-13-27)23-4-3-5-24-21(23)10-17-31-24/h3-10,17-18H,1-2,11-16H2,(H,26,29)
|
|
| InChIKey |
ZKIAIYBUSXZPLP-UHFFFAOYSA-N
|
|
| CAS Number | CAS 913611-97-9 | |
| TTD ID | D0P0OU | |
| DrugBank ID | DB09128 | |
| PubChem Compound ID | 11978813 | |
| PubChem Substance ID | ||
| ChEBI ID | CHEBI:134716 | |
| ADReCS Drug ID | BADD_D00293 |
| ID | Name | Dose | Type | Drug Brand Name | Drug Dose | Drug Dosage Form | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ID | Name | Dose | Type | Drug Brand Name | Drug Dose | Drug Dosage Form | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship classification |