| Drug Name |
Selexipag
|
||
| Synonyms |
Selexipag; NS-304; 475086-01-2; Uptravi; NS 304; ACT-293987; UNII-5EXC0E384L; Selexipag(NS-304); ACT 293987; 5EXC0E384L; 2-(4-((5,6-diphenylpyrazin-2-yl)(isopropyl)amino)butoxy)-N-(methylsulfonyl)acetamide; 2-{4-[N-(5,6-diphenylpyrazin-2-yl)-N-isopropylamino]butyloxy}-N-(methylsulfonyl)acetamide; 2-(4-((5,6-Diphenylpyrazin-2-yl)(propan-2-yl)amino)butoxy}-n-(methanesulfonyl)acetamide; Selexipag [USAN:INN]; 2-{4-[(5,6-diphenylpyrazin-2-yl)(propan-2-yl)amino]butoxy}-N-(methanesulfonyl)acetamide; Uptravi (TN)
|
||
| Drug Type |
Small molecular drug
|
||
| Indications |
Pulmonary arterial hypertension [ICD-11: BB01.0]
|
Approved
|
|
| Company |
Actelion Pharmaceuticals
|
||
| Summary |
Selexipag is a non prostanoid IP prostacyclin receptor agonist used to treat pulmonary arterial hypertension.
|
||
| Target |
Prostacyclin receptor (PTGIR)
Mechanism of Action: Agonist
|
T99954 | |
|
Formula |
C26H32N4O4S
|
| Canonical SMILES |
CC(C)N(CCCCOCC(=O)NS(=O)(=O)C)C1=CN=C(C(=N1)C2=CC=CC=C2)C3=CC=CC=C3
|
|
| InChI |
1S/C26H32N4O4S/c1-20(2)30(16-10-11-17-34-19-24(31)29-35(3,32)33)23-18-27-25(21-12-6-4-7-13-21)26(28-23)22-14-8-5-9-15-22/h4-9,12-15,18,20H,10-11,16-17,19H2,1-3H3,(H,29,31)
|
|
| InChIKey |
QXWZQTURMXZVHJ-UHFFFAOYSA-N
|
|
| CAS Number | CAS 475086-01-2 | |
| TTD ID | D0N2SR | |
| DrugBank ID | DB11362 | |
| PubChem Compound ID | 9913767 | |
| PubChem Substance ID | ||
| ChEBI ID | CHEBI:90844 | |
| ADReCS Drug ID | BADD_D02006 |
| ID | Name | Dose | Type | Drug Brand Name | Drug Dose | Drug Dosage Form | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship Classification | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ID | Name | Dose | Type | Drug Brand Name | Drug Dose | Drug Dosage Form | Experimental Species | Individuals Number | Test Sample | Ingredient | Effect | Relationship classification |